CAS 1157642-22-2 appears in our catalog under these names: 2-(2,4-Difluorophenyl)cyclopropanecarboxylic acid, 95+%, 2-(2,4-Difluorophenyl)cyclopropane-1-carboxylic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2,4-difluorophenyl)cyclopropane-1-carboxylic acid (CAS 1157642-22-2) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 2-(2,4-difluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: RPXLAIOPAHDAFN-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | RPXLAIOPAHDAFN-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)