CAS 1562311-33-4 appears in our catalog under these names: 2,4-Difluoro-5-methylcinnamic acid, 95%, 3-(2,4-Difluoro-5-methylphenyl)acrylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
(E)-3-(2,4-difluoro-5-methylphenyl)prop-2-enoic acid (CAS 1562311-33-4) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: (E)-3-(2,4-difluoro-5-methylphenyl)prop-2-enoic acid. InChIKey: MWQBSOQWLBJURK-NSCUHMNNSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | (E)-3-(2,4-difluoro-5-methylphenyl)prop-2-enoic acid |
| InChIKey | MWQBSOQWLBJURK-NSCUHMNNSA-N |
| SMILES | CC1=CC(=C(C=C1F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)