cas: 845823-12-3 — see every product listed under this CAS number, including other names
1-(3,5-Difluorophenyl)-2,2,2-trifluoroethanone 97% (CAS 845823-12-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A222968-1g |
| cas | 845823-12-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 342.56 Pln | |
| Ambeed | 100g | 1132.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A222968 |
1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone (CAS 845823-12-3) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone. InChIKey: VPJBBHOADBTNFQ-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | VPJBBHOADBTNFQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)