CAS 845823-12-3 appears in our catalog under these names: 2,2,2,3',5'-Pentafluoroacetophenone, 97%, 1-(3,5-Difluorophenyl)-2,2,2-trifluoroethanone 97%, 1-(3,5-Difluorophenyl)-2,2,2-trifluoroethanone, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 100g, 5g.
1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone (CAS 845823-12-3) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone. InChIKey: VPJBBHOADBTNFQ-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | VPJBBHOADBTNFQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)