CAS 134099-20-0 is the registry number for 2,3-Difluoro-4-(trifluoromethyl)benzaldehyde, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
2,3-difluoro-4-(trifluoromethyl)benzaldehyde (CAS 134099-20-0) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 2,3-difluoro-4-(trifluoromethyl)benzaldehyde. InChIKey: RQXOWNQOFWLPSV-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 2,3-difluoro-4-(trifluoromethyl)benzaldehyde |
| InChIKey | RQXOWNQOFWLPSV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)F)F)C(F)(F)F |
Computed by PubChem (NCBI)