Products 134099-20-0

CAS 134099-20-0 is the registry number for 2,3-Difluoro-4-(trifluoromethyl)benzaldehyde, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.

Structural formula: {0} (CAS {1})

2,3-difluoro-4-(trifluoromethyl)benzaldehyde (CAS 134099-20-0) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 2,3-difluoro-4-(trifluoromethyl)benzaldehyde. InChIKey: RQXOWNQOFWLPSV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3F5O
Molecular weight210.10 g/mol
IUPAC name2,3-difluoro-4-(trifluoromethyl)benzaldehyde
InChIKeyRQXOWNQOFWLPSV-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C=O)F)F)C(F)(F)F

Computed by PubChem (NCBI)