1-(3，5-Difluorophenyl)-2，2，2-trifluoroethanone, 97%, 97%
cas: 845823-12-3 — see every product listed under this CAS number, including other names
1-(3，5-Difluorophenyl)-2，2，2-trifluoroethanone, 97%, 97% (CAS 845823-12-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115R17-1g |
| cas | 845823-12-3 |
| size | 1g |
| availability | 125g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 299.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone (CAS 845823-12-3) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone. InChIKey: VPJBBHOADBTNFQ-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | VPJBBHOADBTNFQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
1-(3,5-difluorophenyl)-2,2,2-trifluoroethanone, 2,2,2,3',5'-Pentafluoroacetophenone, 1-(3,5-difluorophenyl)-2,2,2-trifluoroethan-1-one, 2,2,2-trifluoro-3',5'-difluoroacetophenone, 1-(3,5-difluorophenyl)-2,2,2-trifluoro-ethanone, 3',5'-Difluoro-2,2,2-trifluoroacetophenone, 2,2,2,3`,5`-pentafluoroacetophenone, 1-(35-Difluorophenyl)-222-trifluoroethanone, 1-(3,5-Difluoro-phenyl)-2,2,2-trifluoro ethanone, 1-(3,5-difluoro-phenyl)-2,2,2-trifluoro-ethanone