Products 2090130-84-8
CAS 2090130-84-8 is the registry number for 3,5-Difluoro-2-(trifluoromethyl)benzaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-difluoro-2-(trifluoromethyl)benzaldehyde (CAS 2090130-84-8) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 3,5-difluoro-2-(trifluoromethyl)benzaldehyde. InChIKey: FMJMIOFGONAYAM-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 3,5-difluoro-2-(trifluoromethyl)benzaldehyde |
| InChIKey | FMJMIOFGONAYAM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)C(F)(F)F)F)F |
Computed by PubChem (NCBI)