cas: 23699-65-2 — see every product listed under this CAS number, including other names
1-(3-(Phenylamino)phenyl)ethanone (CAS 23699-65-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338135-50MG |
| cas | 23699-65-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 310.33 Pln | |
| Fluorochem | 250mg | 534.20 Pln |
| delivery time | 3-4 weeks |
|---|
1-(3-anilinophenyl)ethanone (CAS 23699-65-2) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 1-(3-anilinophenyl)ethanone. InChIKey: ZWXDAANEJMSCEX-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 1-(3-anilinophenyl)ethanone |
| InChIKey | ZWXDAANEJMSCEX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)