CAS 36192-63-9 appears in our catalog under these names: 2-Amino-4'-methylbenzophenone, 95%, (2-Aminophenyl)(p-tolyl)methanone+, 2-Amino-4'-methylbenzophenone, 97%, 97%, (2-AMINOPHENYL)(P-TOLYL)METHANONE. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 2,5g.
(2-aminophenyl)-(4-methylphenyl)methanone (CAS 36192-63-9) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: (2-aminophenyl)-(4-methylphenyl)methanone. InChIKey: RMMJUQSANCPTMV-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | (2-aminophenyl)-(4-methylphenyl)methanone |
| InChIKey | RMMJUQSANCPTMV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2N |
Computed by PubChem (NCBI)