cas: 106134-16-1 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)-2,2-dihydroxyethan-1-one 95% (CAS 106134-16-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1221128-250mg |
| cas | 106134-16-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 659.62 Pln | |
| Ambeed | 5g | 2028.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1221128 |
2-(3-bromophenyl)-2-oxoacetaldehyde;hydrate (CAS 106134-16-1) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(3-bromophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: BSHAAODAJAWMNJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(3-bromophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | BSHAAODAJAWMNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C=O.O |
Computed by PubChem (NCBI)