cas: 143328-23-8 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)cyclopentane-1-carboxylic acid 97% (CAS 143328-23-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A786841-10g |
| cas | 143328-23-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1405.00 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 904.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A786841 |
1-(3-bromophenyl)cyclopentane-1-carboxylic acid (CAS 143328-23-8) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: 1-(3-bromophenyl)cyclopentane-1-carboxylic acid. InChIKey: LYXFHQXQIYWCHA-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | 1-(3-bromophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | LYXFHQXQIYWCHA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)