cas: 143328-23-8 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)cyclopentanecarboxylic acid, 97%, 97% (CAS 143328-23-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117VC6-100mg |
| cas | 143328-23-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 664.40 Pln | |
| Chemat | 10g | 1062.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromophenyl)cyclopentane-1-carboxylic acid (CAS 143328-23-8) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: 1-(3-bromophenyl)cyclopentane-1-carboxylic acid. InChIKey: LYXFHQXQIYWCHA-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | 1-(3-bromophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | LYXFHQXQIYWCHA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)