1-(3-Bromophenyl)dibenzo[b,d]furan, 95%
cas: 2229864-78-0 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)dibenzo[b,d]furan, 95% (CAS 2229864-78-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1504313-1g |
| cas | 2229864-78-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 286.94 Pln | |
| Ambeed | 25g | 948.88 Pln | |
| Ambeed | 100g | 2918.00 Pln | |
| BLDpharm | 1g | 142.20 Pln | |
| BLDpharm | 5g | 303.25 Pln | |
| BLDpharm | 25g | 1019.67 Pln | |
| BLDpharm | 100g | 3141.14 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-(3-bromophenyl)dibenzofuran (CAS 2229864-78-0) is a chemical compound with the molecular formula C18H11BrO and a molecular weight of 323.2 g/mol. IUPAC name: 1-(3-bromophenyl)dibenzofuran. InChIKey: ZCBGTNAAPYCTQF-UHFFFAOYSA-N.
| Molecular formula | C18H11BrO |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 1-(3-bromophenyl)dibenzofuran |
| InChIKey | ZCBGTNAAPYCTQF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC=C3O2)C4=CC(=CC=C4)Br |
Computed by PubChem (NCBI)