Products 2229864-78-0
CAS 2229864-78-0 appears in our catalog under these names: 1–(3–Bromophenyl)dibenzo(b,d)furan, 1-(3-Bromophenyl)dibenzo[b,d]furan, 98%, 98%, 1-(3-Bromophenyl)dibenzo[b,d]furan, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100mg, 250mg, 1g.
1-(3-bromophenyl)dibenzofuran (CAS 2229864-78-0) is a chemical compound with the molecular formula C18H11BrO and a molecular weight of 323.2 g/mol. IUPAC name: 1-(3-bromophenyl)dibenzofuran. InChIKey: ZCBGTNAAPYCTQF-UHFFFAOYSA-N.
| Molecular formula | C18H11BrO |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 1-(3-bromophenyl)dibenzofuran |
| InChIKey | ZCBGTNAAPYCTQF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC=C3O2)C4=CC(=CC=C4)Br |
Computed by PubChem (NCBI)