Products 955959-86-1
CAS 955959-86-1 is the registry number for 2-(4-Bromophenyl)dibenzo[b,d]furan, 99%, 99%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
2-(4-bromophenyl)dibenzofuran (CAS 955959-86-1) is a chemical compound with the molecular formula C18H11BrO and a molecular weight of 323.2 g/mol. IUPAC name: 2-(4-bromophenyl)dibenzofuran. InChIKey: ALXCEAWHEVDVHS-UHFFFAOYSA-N.
| Molecular formula | C18H11BrO |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 2-(4-bromophenyl)dibenzofuran |
| InChIKey | ALXCEAWHEVDVHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)