Products 1084334-27-9
CAS 1084334-27-9 is the registry number for 2–(3–Bromophenyl)dibenzo(b,d)furan. Offered by: GLPBio. Available pack sizes: 25g, 5g.
2-(3-bromophenyl)dibenzofuran (CAS 1084334-27-9) is a chemical compound with the molecular formula C18H11BrO and a molecular weight of 323.2 g/mol. IUPAC name: 2-(3-bromophenyl)dibenzofuran. InChIKey: NXFRHDBTYGPEDX-UHFFFAOYSA-N.
| Molecular formula | C18H11BrO |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 2-(3-bromophenyl)dibenzofuran |
| InChIKey | NXFRHDBTYGPEDX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)C4=CC(=CC=C4)Br |
Computed by PubChem (NCBI)