CAS 2025367-17-1 appears in our catalog under these names: 2-Bromo-4-phenyldibenzo[b,d]furan, 95%, 95%, 2-Bromo-4-phenyldibenzo[b,d]furan, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-bromo-4-phenyldibenzofuran (CAS 2025367-17-1) is a chemical compound with the molecular formula C18H11BrO and a molecular weight of 323.2 g/mol. IUPAC name: 2-bromo-4-phenyldibenzofuran. InChIKey: UPQXQXQOBQWXJG-UHFFFAOYSA-N.
| Molecular formula | C18H11BrO |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 2-bromo-4-phenyldibenzofuran |
| InChIKey | UPQXQXQOBQWXJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC3=C2OC4=CC=CC=C43)Br |
Computed by PubChem (NCBI)