Products 2148344-64-1
CAS 2148344-64-1 appears in our catalog under these names: 1-[2-[2-(4-Bromophenyl)ethynyl]phenyl]-2,3-butadien-1-one, 95%, 1-[2-[2-(4-Bromophenyl)ethynyl]phenyl]-2,3-butadien-1-one, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[2-[2-(4-bromophenyl)ethynyl]phenyl]buta-2,3-dien-1-one (CAS 2148344-64-1) is a chemical compound with the molecular formula C18H11BrO and a molecular weight of 323.2 g/mol. IUPAC name: 1-[2-[2-(4-bromophenyl)ethynyl]phenyl]buta-2,3-dien-1-one. InChIKey: OGDXWCGUZIBFGI-UHFFFAOYSA-N.
| Molecular formula | C18H11BrO |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 1-[2-[2-(4-bromophenyl)ethynyl]phenyl]buta-2,3-dien-1-one |
| InChIKey | OGDXWCGUZIBFGI-UHFFFAOYSA-N |
| SMILES | C=C=CC(=O)C1=CC=CC=C1C#CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)