cas: 28049-60-7 — see every product listed under this CAS number, including other names
1-(3-Chlorophenyl)cyclobutanecarbonitrile, 90%, 90% (CAS 28049-60-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I60V-250mg |
| cas | 28049-60-7 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 976.40 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
1-(3-chlorophenyl)cyclobutane-1-carbonitrile (CAS 28049-60-7) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 1-(3-chlorophenyl)cyclobutane-1-carbonitrile. InChIKey: HZMRYIISYHOTSF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 1-(3-chlorophenyl)cyclobutane-1-carbonitrile |
| InChIKey | HZMRYIISYHOTSF-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C#N)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)