CAS 352205-97-1 is the registry number for 4-Chloro-5,7-dimethylquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-chloro-5,7-dimethylquinoline (CAS 352205-97-1) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 4-chloro-5,7-dimethylquinoline. InChIKey: DEARECYODQYXRO-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 4-chloro-5,7-dimethylquinoline |
| InChIKey | DEARECYODQYXRO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=CC(=C2C(=C1)C)Cl |
Computed by PubChem (NCBI)