Products 124276-34-2
CAS 124276-34-2 appears in our catalog under these names: 1–(3–Chlorophenyl)cyclopropanecarboxylic Acid, 1-(3-Chlorophenyl)cyclopropanecarboxylic Acid, 95%, 95%, 1-(3-Chlorophenyl)cyclopropanecarboxylic acid, 97%, 1-(3-Chlorophenyl)cyclopropanecarboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
1-(3-chlorophenyl)cyclopropane-1-carboxylic acid (CAS 124276-34-2) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 1-(3-chlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: QUIQAEWPDRXLFW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 1-(3-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | QUIQAEWPDRXLFW-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)