CAS 4157-47-5 appears in our catalog under these names: rac-(1r,2r)-2-(4-Chlorophenyl)cyclopropane-1-carboxylic acid, 95%, Trans-2-(4-chloro-phenyl)-cyclopropanecarboxylic acid, rac-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid, >95%, >95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg, 100mg.
Trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid (CAS 4157-47-5) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: JZYXJKBNUJJIKU-DTWKUNHWSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | JZYXJKBNUJJIKU-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)