CAS 1273676-14-4 appears in our catalog under these names: 5-Chloro-7-methoxy-2,3-dihydro-1h-inden-1-one, 95%, 5–Chloro–7–methoxy–2,3–dihydro–1H–inden–1–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
5-chloro-7-methoxy-2,3-dihydroinden-1-one (CAS 1273676-14-4) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 5-chloro-7-methoxy-2,3-dihydroinden-1-one. InChIKey: KTWVPXXMTRMYIM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 5-chloro-7-methoxy-2,3-dihydroinden-1-one |
| InChIKey | KTWVPXXMTRMYIM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1C(=O)CC2)Cl |
Computed by PubChem (NCBI)