Products 141106-24-3
CAS 141106-24-3 appears in our catalog under these names: 9-Chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-one, 95%, 9-Chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
9-chloro-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 141106-24-3) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 9-chloro-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: SZQUVULWIGCGSM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 9-chloro-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | SZQUVULWIGCGSM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C(=CC=C2)Cl)OC1 |
Computed by PubChem (NCBI)