CAS 1181230-38-5 appears in our catalog under these names: 2-(2-Chlorophenyl)cyclopropanecarboxylic acid, 95%, 2-(2-Chlorophenyl)-cyclopropanecarboxylic Acid, 2–(2–Chlorophenyl)cyclopropanecarboxylic Acid, 2-(2-Chlorophenyl)cyclopropanecarboxylic acid 95%, 2-(2-Chlorophenyl)cyclopropanecarboxylic Acid, 95%, 95%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 50mg, 500mg.
2-(2-chlorophenyl)cyclopropane-1-carboxylic acid (CAS 1181230-38-5) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 2-(2-chlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: FXRZNBPQNVOJTP-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 2-(2-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | FXRZNBPQNVOJTP-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)