CAS 732248-80-5 appears in our catalog under these names: 2-(2-Chloro-2-propenyl)benzoic acid, 95%, 2–(2–Chloro–2–propenyl)benzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g.
2-(2-chloroprop-2-enyl)benzoic acid (CAS 732248-80-5) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 2-(2-chloroprop-2-enyl)benzoic acid. InChIKey: VNIUVKHWLVUEPR-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 2-(2-chloroprop-2-enyl)benzoic acid |
| InChIKey | VNIUVKHWLVUEPR-UHFFFAOYSA-N |
| SMILES | C=C(CC1=CC=CC=C1C(=O)O)Cl |
Computed by PubChem (NCBI)