cas: 2138165-91-8 — see every product listed under this CAS number, including other names
1-(3-Fluoro-4-methylphenyl)ethanamine hydrochloride, 97% (CAS 2138165-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546783-100MG |
| cas | 2138165-91-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 575.86 Pln | |
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 2668.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride (CAS 2138165-91-8) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: 1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride. InChIKey: JBLAOTNJWNXKOA-UHFFFAOYSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | 1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | JBLAOTNJWNXKOA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)N)F.Cl |
Computed by PubChem (NCBI)