Products 1337699-16-7
CAS 1337699-16-7 is the registry number for 5,6-Dibromo-2,3-dihydrobenzofuran-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dibromo-2,3-dihydro-1-benzofuran-3-amine (CAS 1337699-16-7) is a chemical compound with the molecular formula C8H7Br2NO and a molecular weight of 292.95 g/mol. IUPAC name: 5,6-dibromo-2,3-dihydro-1-benzofuran-3-amine. InChIKey: SRBMCLZOKJSOIE-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO |
|---|---|
| Molecular weight | 292.95 g/mol |
| IUPAC name | 5,6-dibromo-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | SRBMCLZOKJSOIE-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC(=C(C=C2O1)Br)Br)N |
Computed by PubChem (NCBI)