CAS 2408330-99-2 is the registry number for 4,6-Dibromo-1,3-dihydroisobenzofuran-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dibromo-1,3-dihydro-2-benzofuran-5-amine (CAS 2408330-99-2) is a chemical compound with the molecular formula C8H7Br2NO and a molecular weight of 292.95 g/mol. IUPAC name: 4,6-dibromo-1,3-dihydro-2-benzofuran-5-amine. InChIKey: AWBBTGIHOBVOTB-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO |
|---|---|
| Molecular weight | 292.95 g/mol |
| IUPAC name | 4,6-dibromo-1,3-dihydro-2-benzofuran-5-amine |
| InChIKey | AWBBTGIHOBVOTB-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C(=C2CO1)Br)N)Br |
Computed by PubChem (NCBI)