CAS 195134-91-9 is the registry number for 1-(2-Amino-4,6-dibromophenyl)ethanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-amino-4,6-dibromophenyl)ethanone (CAS 195134-91-9) is a chemical compound with the molecular formula C8H7Br2NO and a molecular weight of 292.95 g/mol. IUPAC name: 1-(2-amino-4,6-dibromophenyl)ethanone. InChIKey: PCZWUEILDOCKSI-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO |
|---|---|
| Molecular weight | 292.95 g/mol |
| IUPAC name | 1-(2-amino-4,6-dibromophenyl)ethanone |
| InChIKey | PCZWUEILDOCKSI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1Br)Br)N |
Computed by PubChem (NCBI)