CAS 289039-51-6 is the registry number for 3,5-Dibromo-4-methylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3,5-dibromo-4-methylbenzamide (CAS 289039-51-6) is a chemical compound with the molecular formula C8H7Br2NO and a molecular weight of 292.95 g/mol. IUPAC name: 3,5-dibromo-4-methylbenzamide. InChIKey: ISHWDFOFBAHPLV-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO |
|---|---|
| Molecular weight | 292.95 g/mol |
| IUPAC name | 3,5-dibromo-4-methylbenzamide |
| InChIKey | ISHWDFOFBAHPLV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)C(=O)N)Br |
Computed by PubChem (NCBI)