Products 2757731-73-8
CAS 2757731-73-8 is the registry number for 6-(Bromomethyl)benzo[d]oxazole hydrobromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-(bromomethyl)-1,3-benzoxazole;hydrobromide (CAS 2757731-73-8) is a chemical compound with the molecular formula C8H7Br2NO and a molecular weight of 292.95 g/mol. IUPAC name: 6-(bromomethyl)-1,3-benzoxazole;hydrobromide. InChIKey: WFPDKYFJCBVULW-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO |
|---|---|
| Molecular weight | 292.95 g/mol |
| IUPAC name | 6-(bromomethyl)-1,3-benzoxazole;hydrobromide |
| InChIKey | WFPDKYFJCBVULW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CBr)OC=N2.Br |
Computed by PubChem (NCBI)