cas: 78427-26-6 — see every product listed under this CAS number, including other names
1-(4-Aminophenyl)pyridin-1-ium chloride, 95%, 95% (CAS 78427-26-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116LYT-250mg |
| cas | 78427-26-6 |
| size | 250mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 2709.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-pyridin-1-ium-1-ylaniline chloride (CAS 78427-26-6) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 4-pyridin-1-ium-1-ylaniline chloride. InChIKey: MCJGOGUUDJHLPZ-UHFFFAOYSA-M.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 4-pyridin-1-ium-1-ylaniline chloride |
| InChIKey | MCJGOGUUDJHLPZ-UHFFFAOYSA-M |
| SMILES | C1=CC=[N+](C=C1)C2=CC=C(C=C2)N.[Cl-] |
Computed by PubChem (NCBI)