CAS 1798733-74-0 appears in our catalog under these names: 4-Phenylpyridin-3-amine hydrochloride, 95%, 4-Phenylpyridin-3-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10g.
4-phenylpyridin-3-amine;hydrochloride (CAS 1798733-74-0) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 4-phenylpyridin-3-amine;hydrochloride. InChIKey: QVZWNMDPAAFFLG-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 4-phenylpyridin-3-amine;hydrochloride |
| InChIKey | QVZWNMDPAAFFLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=NC=C2)N.Cl |
Computed by PubChem (NCBI)