CAS 916766-83-1 appears in our catalog under these names: 3-[4-(Chloromethyl)phenyl]-1-methyl-1h-pyrazole, 97%, 3–(4–(Chloromethyl)phenyl)–1–methyl–1H–pyrazole. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 1g.
3-[4-(chloromethyl)phenyl]-1-methylpyrazole (CAS 916766-83-1) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 3-[4-(chloromethyl)phenyl]-1-methylpyrazole. InChIKey: YLJMPTWMRVXTQQ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 3-[4-(chloromethyl)phenyl]-1-methylpyrazole |
| InChIKey | YLJMPTWMRVXTQQ-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)C2=CC=C(C=C2)CCl |
Computed by PubChem (NCBI)