CAS 861204-95-7 appears in our catalog under these names: 1-Benzyl-4-(chloromethyl)-1h-pyrazole, 95%, 1-Benzyl-4-(chloromethyl)-1H-pyrazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
1-benzyl-4-(chloromethyl)pyrazole (CAS 861204-95-7) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 1-benzyl-4-(chloromethyl)pyrazole. InChIKey: ULBADXYYKLOCGK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 1-benzyl-4-(chloromethyl)pyrazole |
| InChIKey | ULBADXYYKLOCGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)CCl |
Computed by PubChem (NCBI)