CAS 19685-84-8 appears in our catalog under these names: 8-Chloro-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole, 97%, 8-Chloro-2,3,4,5-tetrahydro-1H-pyrido(4,3-b)-indole, 8-Chloro-2,3,4,5-Tetrahydro-1H-Pyrido[4,3-B]Indole, 95%, 95%, 8-Chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 2,5g, 100mg.
8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (CAS 19685-84-8) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole. InChIKey: LCKUBQBEDRQTRC-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| InChIKey | LCKUBQBEDRQTRC-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)