CAS 23046-68-6 is the registry number for 6-Chloro-2,3,4,9-tetrahydro-1h-beta-carboline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (CAS 23046-68-6) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole. InChIKey: SXHJWBRJNQZWBI-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| InChIKey | SXHJWBRJNQZWBI-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)