1-(4-Boronophenyl)cyclopropanecarboxylic acid, 98%
cas: 1159489-46-9 — see every product listed under this CAS number, including other names
1-(4-Boronophenyl)cyclopropanecarboxylic acid, 98% (CAS 1159489-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A187341-100mg |
| cas | 1159489-46-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1238.12 Pln | |
| Ambeed | 5g | 3835.81 Pln | |
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 500mg | 650.00 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2541.20 Pln | |
| Chemat | 10g | 4542.80 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 575.38 Pln | |
| BLDpharm | 1g | 1330.67 Pln | |
| BLDpharm | 5g | 4135.24 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-(4-boronophenyl)cyclopropane-1-carboxylic acid (CAS 1159489-46-9) is a chemical compound with the molecular formula C10H11BO4 and a molecular weight of 206.00 g/mol. IUPAC name: 1-(4-boronophenyl)cyclopropane-1-carboxylic acid. InChIKey: PUBSPRJVEBBDPX-UHFFFAOYSA-N.
| Molecular formula | C10H11BO4 |
|---|---|
| Molecular weight | 206.00 g/mol |
| IUPAC name | 1-(4-boronophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | PUBSPRJVEBBDPX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CC2)C(=O)O)(O)O |
Computed by PubChem (NCBI)