CAS 372193-68-5 appears in our catalog under these names: (E)-(2-(3-Methoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid 97%, 2-(E-3-Methoxy-3-oxo-1-propen-1-yl)phenylboronic acid, 97%, 97%, (2-(3-Methoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
[2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid (CAS 372193-68-5) is a chemical compound with the molecular formula C10H11BO4 and a molecular weight of 206.00 g/mol. IUPAC name: [2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid. InChIKey: WUEIYHVPDHJGLC-VOTSOKGWSA-N.
| Molecular formula | C10H11BO4 |
|---|---|
| Molecular weight | 206.00 g/mol |
| IUPAC name | [2-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid |
| InChIKey | WUEIYHVPDHJGLC-VOTSOKGWSA-N |
| SMILES | B(C1=CC=CC=C1/C=C/C(=O)OC)(O)O |
Computed by PubChem (NCBI)