CAS 179942-50-8 is the registry number for (4-(3-Methoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid, 98% mix TBC as stabilizer. Offered by: AmBeed. Available pack sizes: 5g.
[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid (CAS 179942-50-8) is a chemical compound with the molecular formula C10H11BO4 and a molecular weight of 206.00 g/mol. IUPAC name: [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid. InChIKey: BIKAXBPCHWDATP-QPJJXVBHSA-N.
| Molecular formula | C10H11BO4 |
|---|---|
| Molecular weight | 206.00 g/mol |
| IUPAC name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid |
| InChIKey | BIKAXBPCHWDATP-QPJJXVBHSA-N |
| SMILES | B(C1=CC=C(C=C1)/C=C/C(=O)OC)(O)O |
Computed by PubChem (NCBI)