CAS 1107596-00-8 is the registry number for 3-Carboxyphenylboronic acid propanediol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(1,3,2-dioxaborinan-2-yl)benzoic acid (CAS 1107596-00-8) is a chemical compound with the molecular formula C10H11BO4 and a molecular weight of 206.00 g/mol. IUPAC name: 3-(1,3,2-dioxaborinan-2-yl)benzoic acid. InChIKey: VBPHVROQWZGKMS-UHFFFAOYSA-N.
| Molecular formula | C10H11BO4 |
|---|---|
| Molecular weight | 206.00 g/mol |
| IUPAC name | 3-(1,3,2-dioxaborinan-2-yl)benzoic acid |
| InChIKey | VBPHVROQWZGKMS-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)