Products 126747-13-5
CAS 126747-13-5 appears in our catalog under these names: 4-(1,3,2-Dioxaborinan-2-yl)benzoic acid, 95-<97%, 4-(1,3,2-Dioxaborinan-2-yl)benzoic acid, ≥97-<99%, 4-(1,3,2-dioxaborinan-2-yl)benzoic acid 97%, 4-(1,3,2-dioxaborinan-2-yl)benzoic acid, 97% ,, 97% ,, 4-(1,3,2-dioxaborinan-2-yl)benzoic acid, 95%(LC-MS),RG. Offered by: Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 200g, 300g, 400g, 500g, 600g, 250mg, 1g.
4-(1,3,2-dioxaborinan-2-yl)benzoic acid (CAS 126747-13-5) is a chemical compound with the molecular formula C10H11BO4 and a molecular weight of 206.00 g/mol. IUPAC name: 4-(1,3,2-dioxaborinan-2-yl)benzoic acid. InChIKey: YYTULIYDVGLPGK-UHFFFAOYSA-N.
| Molecular formula | C10H11BO4 |
|---|---|
| Molecular weight | 206.00 g/mol |
| IUPAC name | 4-(1,3,2-dioxaborinan-2-yl)benzoic acid |
| InChIKey | YYTULIYDVGLPGK-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)