cas: 1159976-87-0 — see every product listed under this CAS number, including other names
1-(4-Bromo-2-chlorophenyl)-N,N-dimethylmethanamine, 97%, 97% (CAS 1159976-87-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1106IO-250mg |
| cas | 1159976-87-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 678.80 Pln | |
| Chemat | 5g | 2090.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-2-chlorophenyl)-N,N-dimethylmethanamine (CAS 1159976-87-0) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 1-(4-bromo-2-chlorophenyl)-N,N-dimethylmethanamine. InChIKey: JLWNFCWRKLVYQT-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 1-(4-bromo-2-chlorophenyl)-N,N-dimethylmethanamine |
| InChIKey | JLWNFCWRKLVYQT-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)