CAS 1306604-68-1 appears in our catalog under these names: Cyclopropanamine, 2-(4-bromophenyl)-, hydrochloride (1:1), 90%, 90%, 2–(4–bromophenyl)cyclopropan–1–amine hydrochloride, 2-(4-Bromophenyl)cyclopropan-1-amine hydrochloride, 95%, 2-(4-Bromophenyl)cyclopropanamine hydrochloride 95%, 2-(4-BROMOPHENYL)CYCLOPROPANAMINE HCL, 90%. Offered by: Chemat, GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25mg.
2-(4-bromophenyl)cyclopropan-1-amine;hydrochloride (CAS 1306604-68-1) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 2-(4-bromophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: XQXNVLZRIWWINX-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 2-(4-bromophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | XQXNVLZRIWWINX-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)