cas: 1176645-11-6 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-methylphenyl)-3,5-dimethyl-1H-pyrazole, ≥95%, ≥95% (CAS 1176645-11-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132PXO-1g |
| cas | 1176645-11-6 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1346.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-3-methylphenyl)-3,5-dimethylpyrazole (CAS 1176645-11-6) is a chemical compound with the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. IUPAC name: 1-(4-bromo-3-methylphenyl)-3,5-dimethylpyrazole. InChIKey: LHHSYEPECSEEET-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2 |
|---|---|
| Molecular weight | 265.15 g/mol |
| IUPAC name | 1-(4-bromo-3-methylphenyl)-3,5-dimethylpyrazole |
| InChIKey | LHHSYEPECSEEET-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC(=C(C=C2)Br)C)C |
Computed by PubChem (NCBI)