cas: 1314760-71-8 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-methylphenyl)cyclopropane-1-carbonitrile, 98% (CAS 1314760-71-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F638119-100MG |
| cas | 1314760-71-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 919.49 Pln | |
| Fluorochem | 1g | 1893.10 Pln | |
| Fluorochem | 5g | 6355.07 Pln | |
| Fluorochem | 10g | 12014.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-bromo-3-methylphenyl)cyclopropane-1-carbonitrile (CAS 1314760-71-8) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 1-(4-bromo-3-methylphenyl)cyclopropane-1-carbonitrile. InChIKey: XAIQSXRKYAMDRT-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 1-(4-bromo-3-methylphenyl)cyclopropane-1-carbonitrile |
| InChIKey | XAIQSXRKYAMDRT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2(CC2)C#N)Br |
Computed by PubChem (NCBI)