CAS 203506-39-2 is the registry number for 4-Bromo-2,8-dimethylquinoline, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
4-bromo-2,8-dimethylquinoline (CAS 203506-39-2) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 4-bromo-2,8-dimethylquinoline. InChIKey: KWILRJMGQJUZIQ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 4-bromo-2,8-dimethylquinoline |
| InChIKey | KWILRJMGQJUZIQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)C)Br |
Computed by PubChem (NCBI)