cas: 843608-46-8 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, 97% (CAS 843608-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223704-100MG |
| cas | 843608-46-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 2840.68 Pln | |
| Fluorochem | 10g | 5110.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-bromophenyl)-2,2,2-trifluoroethanamine (CAS 843608-46-8) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZUFCCCNTJRQNCF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZUFCCCNTJRQNCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)Br |
Computed by PubChem (NCBI)