1-(4-Bromophenyl)Cyclohexanecarboxylic Acid, 95%
cas: 732308-80-4 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)Cyclohexanecarboxylic Acid, 95% (CAS 732308-80-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11FEM9-100mg |
| cas | 732308-80-4 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3371.60 Pln | |
| Fluorochem | 100mg | 737.26 Pln | |
| Fluorochem | 250mg | 992.38 Pln | |
| Fluorochem | 1g | 2028.47 Pln | |
| Fluorochem | 5g | 6256.15 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenyl)cyclohexane-1-carboxylic acid (CAS 732308-80-4) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: 1-(4-bromophenyl)cyclohexane-1-carboxylic acid. InChIKey: JJVXUXDLDJORKK-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 1-(4-bromophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | JJVXUXDLDJORKK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)